C30H38F2N4O2S — CID 91289471
N-[(2S,3R)-4-(cyclohexylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-ethyl-9-methyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide (PubChem CID 91289471) has the molecular formula C30H38F2N4O2S and a molecular weight of 556.72 g/mol. Its IUPAC name is N-[(2S,3R)-4-(cyclohexylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-ethyl-9-methyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | N-[(2S,3R)-4-(cyclohexylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-ethyl-9-methyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 91289471 |
| Molecular Formula | C30H38F2N4O2S |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | N-[(2S,3R)-4-(cyclohexylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-ethyl-9-methyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCc1cn2c3c(cc(C(=O)N[C@@H](Cc4cc(F)cc(F)c4)[C@H](O)CNC4CCCCC4)cc13)N(C)SCC2 |
| InChI | InChI=1S/C30H38F2N4O2S/c1-3-20-18-36-9-10-39-35(2)27-15-21(14-25(20)29(27)36)30(38)34-26(13-19-11-22(31)16-23(32)12-19)28(37)17-33-24-7-5-4-6-8-24/h11-12,14-16,18,24,26,28,33,37H,3-10,13,17H2,1-2H3,(H,34,38)/t26-,28+/m0/s1 |
| InChIKey | BNJTZJNYBNUFPB-XTEPFMGCSA-N |
| XLogP | 5.20 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|