C28H34O4 — CID 91289555
(7R,8S,10S,13S,14S,17R)-7,10,13-trimethyl-7-(5-methylfuran-2-yl)spiro[1,2,4,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 91289555) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (7R,8S,10S,13S,14S,17R)-7,10,13-trimethyl-7-(5-methylfuran-2-yl)spiro[1,2,4,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (7R,8S,10S,13S,14S,17R)-7,10,13-trimethyl-7-(5-methylfuran-2-yl)spiro[1,2,4,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 91289555 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (7R,8S,10S,13S,14S,17R)-7,10,13-trimethyl-7-(5-methylfuran-2-yl)spiro[1,2,4,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | Cc1ccc([C@]2(C)C=C3CC(=O)CC[C@]3(C)C3=CC[C@@]4(C)[C@@H](CC[C@@]45CCC(=O)O5)[C@@H]32)o1 |
| InChI | InChI=1S/C28H34O4/c1-17-5-6-22(31-17)26(3)16-18-15-19(29)7-11-25(18,2)20-8-12-27(4)21(24(20)26)9-13-28(27)14-10-23(30)32-28/h5-6,8,16,21,24H,7,9-15H2,1-4H3/t21-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | FFHRPBQOWFQHOV-GDPSMPDASA-N |
| XLogP | 5.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|