C17H30N2O4S — CID 91290764
5-hydroxy-3-imino-4,4-dimethyl-N-[2-methyl-2-[2-(oxolan-3-yl)ethylsulfanyl]propanoyl]pentanamide (PubChem CID 91290764) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is 5-hydroxy-3-imino-4,4-dimethyl-N-[2-methyl-2-[2-(oxolan-3-yl)ethylsulfanyl]propanoyl]pentanamide.
| Compound Name | 5-hydroxy-3-imino-4,4-dimethyl-N-[2-methyl-2-[2-(oxolan-3-yl)ethylsulfanyl]propanoyl]pentanamide |
|---|---|
| PubChem CID | 91290764 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-hydroxy-3-imino-4,4-dimethyl-N-[2-methyl-2-[2-(oxolan-3-yl)ethylsulfanyl]propanoyl]pentanamide |
| SMILES | [H]/N=C(/CC(=O)NC(=O)C(C)(C)SCCC1CCOC1)C(C)(C)CO |
| InChI | InChI=1S/C17H30N2O4S/c1-16(2,11-20)13(18)9-14(21)19-15(22)17(3,4)24-8-6-12-5-7-23-10-12/h12,18,20H,5-11H2,1-4H3,(H,19,21,22)/b18-13- |
| InChIKey | XZDBOPNVUIZUSQ-AQTBWJFISA-N |
| XLogP | 2.00 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|