C14H24N2O4 — CID 91447995
N-acetyl-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide (PubChem CID 91447995) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-acetyl-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide.
| Compound Name | N-acetyl-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide |
|---|---|
| PubChem CID | 91447995 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-acetyl-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide |
| SMILES | [H]/N=C(\CC(=O)NC(C)=O)C(C)(C)COC1CCCCO1 |
| InChI | InChI=1S/C14H24N2O4/c1-10(17)16-12(18)8-11(15)14(2,3)9-20-13-6-4-5-7-19-13/h13,15H,4-9H2,1-3H3,(H,16,17,18)/b15-11+ |
| InChIKey | JHARIWXOJCFTBZ-RVDMUPIBSA-N |
| XLogP | 1.63 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|