C20H35N3O5 — CID 148772878
3-amino-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropanoyl]-4,4-dimethyl-5-(oxan-2-yloxy)pent-2-enamide (PubChem CID 148772878) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-amino-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropanoyl]-4,4-dimethyl-5-(oxan-2-yloxy)pent-2-enamide.
| Compound Name | 3-amino-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropanoyl]-4,4-dimethyl-5-(oxan-2-yloxy)pent-2-enamide |
|---|---|
| PubChem CID | 148772878 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 3-amino-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-methylpropanoyl]-4,4-dimethyl-5-(oxan-2-yloxy)pent-2-enamide |
| SMILES | CC(C)(COC1CCCCO1)C(N)=CC(=O)NC(=O)C(C)(C)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C20H35N3O5/c1-19(2,13-28-17-7-5-6-10-27-17)15(21)11-16(25)22-18(26)20(3,4)23-9-8-14(24)12-23/h11,14,17,24H,5-10,12-13,21H2,1-4H3,(H,22,25,26)/t14-,17?/m0/s1 |
| InChIKey | CWYFIHVCQXURQN-MBIQTGHCSA-N |
| XLogP | 0.89 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|