C21H39N3O4 — CID 91443752
N-[2-[butan-2-yl(methyl)amino]-2-methylpropanoyl]-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide (PubChem CID 91443752) has the molecular formula C21H39N3O4 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methyl)amino]-2-methylpropanoyl]-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide.
| Compound Name | N-[2-[butan-2-yl(methyl)amino]-2-methylpropanoyl]-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide |
|---|---|
| PubChem CID | 91443752 |
| Molecular Formula | C21H39N3O4 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.29 |
| IUPAC Name | N-[2-[butan-2-yl(methyl)amino]-2-methylpropanoyl]-3-imino-4,4-dimethyl-5-(oxan-2-yloxy)pentanamide |
| SMILES | [H]/N=C(\CC(=O)NC(=O)C(C)(C)N(C)C(C)CC)C(C)(C)COC1CCCCO1 |
| InChI | InChI=1S/C21H39N3O4/c1-8-15(2)24(7)21(5,6)19(26)23-17(25)13-16(22)20(3,4)14-28-18-11-9-10-12-27-18/h15,18,22H,8-14H2,1-7H3,(H,23,25,26)/b22-16+ |
| InChIKey | ISAQQBMOQCKGIG-CJLVFECKSA-N |
| XLogP | 3.12 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|