C21H19BN3O4S — CID 91291754
CID 91291754 (PubChem CID 91291754) has the molecular formula C21H19BN3O4S and a molecular weight of 422.29 g/mol.
| Compound Name | CID 91291754 |
|---|---|
| PubChem CID | 91291754 |
| Molecular Formula | C21H19BN3O4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCCC12CCC(C)(O1)c1c2c(O)n(-c2ccc(C#N)c3ncccc23)c1O |
| InChI | InChI=1S/C21H19BN3O4S/c1-20-6-7-21(29-20,8-10-28-30-22)16-15(20)18(26)25(19(16)27)14-5-4-12(11-23)17-13(14)3-2-9-24-17/h2-5,9,22,26-27H,6-8,10H2,1H3/i22T |
| InChIKey | VHLIEVACHSHGGB-SURVTVKHSA-N |
| XLogP | 3.41 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|