About CID 91291754
CID 91291754 (PubChem CID 91291754) has the molecular formula C21H19BN3O4S
and a molecular weight of 422.29 g/mol.
Molecular Properties
| Compound Name | CID 91291754 |
| PubChem CID | 91291754 |
| Molecular Formula | C21H19BN3O4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCCC12CCC(C)(O1)c1c2c(O)n(-c2ccc(C#N)c3ncccc23)c1O |
| InChI | InChI=1S/C21H19BN3O4S/c1-20-6-7-21(29-20,8-10-28-30-22)16-15(20)18(26)25(19(16)27)14-5-4-12(11-23)17-13(14)3-2-9-24-17/h2-5,9,22,26-27H,6-8,10H2,1H3/i22T |
| InChIKey | VHLIEVACHSHGGB-SURVTVKHSA-N |
| XLogP | 3.41 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 91291754 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91291754?
The IUPAC name of CID 91291754 (CID 91291754) is not available.
What is the SMILES notation for CID 91291754?
The canonical SMILES for CID 91291754 is [3H][B]SOCCC12CCC(C)(O1)c1c2c(O)n(-c2ccc(C#N)c3ncccc23)c1O.
What is the InChIKey of CID 91291754?
The InChIKey is VHLIEVACHSHGGB-SURVTVKHSA-N. The full InChI is InChI=1S/C21H19BN3O4S/c1-20-6-7-21(29-20,8-10-28-30-22)16-15(20)18(26)25(19(16)27)14-5-4-12(11-23)17-13(14)3-2-9-24-17/h2-5,9,22,26-27H,6-8,10H2,1H3/i22T.
What are the key properties of CID 91291754?
CID 91291754 has a molecular weight of 422.29 g/mol, XLogP of 3.41, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91291754 is sourced from PubChem (CID 91291754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).