C28H21ClN4O5 — CID 91599615
5-[(4S,7S)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 91599615) has the molecular formula C28H21ClN4O5 and a molecular weight of 528.95 g/mol. Its IUPAC name is 5-[(4S,7S)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4S,7S)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 91599615 |
| Molecular Formula | C28H21ClN4O5 |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 5-[(4S,7S)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@]12CC[C@@](CCOc3noc4ccc(Cl)cc34)(O1)c1c2c(O)n(-c2ccc(C#N)c3ncccc23)c1O |
| InChI | InChI=1S/C28H21ClN4O5/c1-27-8-9-28(38-27,10-12-36-24-18-13-16(29)5-7-20(18)37-32-24)22-21(27)25(34)33(26(22)35)19-6-4-15(14-30)23-17(19)3-2-11-31-23/h2-7,11,13,34-35H,8-10,12H2,1H3/t27-,28-/m0/s1 |
| InChIKey | BCQIFBHOJZJZCD-NSOVKSMOSA-N |
| XLogP | 5.81 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |