C18H12N2O2S — CID 912920
(1R)-3-amino-5-hydroxy-1-thiophen-3-yl-1H-benzo[f]chromene-2-carbonitrile (PubChem CID 912920) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is (1R)-3-amino-5-hydroxy-1-thiophen-3-yl-1H-benzo[f]chromene-2-carbonitrile.
| Compound Name | (1R)-3-amino-5-hydroxy-1-thiophen-3-yl-1H-benzo[f]chromene-2-carbonitrile |
|---|---|
| PubChem CID | 912920 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (1R)-3-amino-5-hydroxy-1-thiophen-3-yl-1H-benzo[f]chromene-2-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(O)cc3ccccc3c2[C@H]1c1ccsc1 |
| InChI | InChI=1S/C18H12N2O2S/c19-8-13-15(11-5-6-23-9-11)16-12-4-2-1-3-10(12)7-14(21)17(16)22-18(13)20/h1-7,9,15,21H,20H2/t15-/m0/s1 |
| InChIKey | CSRKUFJIAPRYOO-HNNXBMFYSA-N |
| XLogP | 3.83 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |