C18H20N3O5P — CID 91293240
[(2R)-3-(1H-indol-3-yl)-2-(N-methoxyanilino)propanoyl]oxyphosphonamidic acid (PubChem CID 91293240) has the molecular formula C18H20N3O5P and a molecular weight of 389.35 g/mol. Its IUPAC name is [(2R)-3-(1H-indol-3-yl)-2-(N-methoxyanilino)propanoyl]oxyphosphonamidic acid.
| Compound Name | [(2R)-3-(1H-indol-3-yl)-2-(N-methoxyanilino)propanoyl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 91293240 |
| Molecular Formula | C18H20N3O5P |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(2R)-3-(1H-indol-3-yl)-2-(N-methoxyanilino)propanoyl]oxyphosphonamidic acid |
| SMILES | CON(c1ccccc1)[C@H](Cc1c[nH]c2ccccc12)C(=O)OP(N)(=O)O |
| InChI | InChI=1S/C18H20N3O5P/c1-25-21(14-7-3-2-4-8-14)17(18(22)26-27(19,23)24)11-13-12-20-16-10-6-5-9-15(13)16/h2-10,12,17,20H,11H2,1H3,(H3,19,23,24)/t17-/m1/s1 |
| InChIKey | VBDYSPADTSRYOW-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|