C11H15NO2 — CID 91293262
methyl 8-imino-7-methylcycloocta-1,6-diene-1-carboxylate (PubChem CID 91293262) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 8-imino-7-methylcycloocta-1,6-diene-1-carboxylate.
| Compound Name | methyl 8-imino-7-methylcycloocta-1,6-diene-1-carboxylate |
|---|---|
| PubChem CID | 91293262 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 8-imino-7-methylcycloocta-1,6-diene-1-carboxylate |
| SMILES | [H]/N=C1\C(C)=CCCCC=C1C(=O)OC |
| InChI | InChI=1S/C11H15NO2/c1-8-6-4-3-5-7-9(10(8)12)11(13)14-2/h6-7,12H,3-5H2,1-2H3/b8-6?,9-7?,12-10+ |
| InChIKey | ZUCLEYJVTPVCFE-QPVUXHGESA-N |
| XLogP | 2.24 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|