C11H15NO6 — CID 91297564
2-(2,5-dihydroxypyrrol-1-yl)-2-methylhexanedioic acid (PubChem CID 91297564) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-2-methylhexanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-methylhexanedioic acid |
|---|---|
| PubChem CID | 91297564 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-methylhexanedioic acid |
| SMILES | CC(CCCC(=O)O)(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C11H15NO6/c1-11(10(17)18,6-2-3-9(15)16)12-7(13)4-5-8(12)14/h4-5,13-14H,2-3,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | CHYTZBPCFGDPED-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |