C10H15NO4 — CID 123362735
2-(2,5-dihydroxypyrrol-1-yl)-4-methylpentanoic acid (PubChem CID 123362735) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-4-methylpentanoic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 123362735 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO4/c1-6(2)5-7(10(14)15)11-8(12)3-4-9(11)13/h3-4,6-7,12-13H,5H2,1-2H3,(H,14,15) |
| InChIKey | MWGGTFLNZAEACB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |