C26H31N3O4 — CID 91301071
butyl 2-[4-[[2-ethoxy-4-ethyl-5-(nitrosomethyl)imidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 91301071) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is butyl 2-[4-[[2-ethoxy-4-ethyl-5-(nitrosomethyl)imidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | butyl 2-[4-[[2-ethoxy-4-ethyl-5-(nitrosomethyl)imidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 91301071 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | butyl 2-[4-[[2-ethoxy-4-ethyl-5-(nitrosomethyl)imidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1-c1ccc(Cn2c(OCC)nc(CC)c2CN=O)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-4-7-16-33-25(30)22-11-9-8-10-21(22)20-14-12-19(13-15-20)18-29-24(17-27-31)23(5-2)28-26(29)32-6-3/h8-15H,4-7,16-18H2,1-3H3 |
| InChIKey | WZAYXMCRVXDCJD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|