C16H19N3O2 — CID 91302146
4-(4-imino-2-oxopentyl)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 91302146) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(4-imino-2-oxopentyl)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(4-imino-2-oxopentyl)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 91302146 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-(4-imino-2-oxopentyl)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | [H]/N=C(\C)CC(=O)Cc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C16H19N3O2/c1-11(17)9-14(20)10-15-12(2)18(3)19(16(15)21)13-7-5-4-6-8-13/h4-8,17H,9-10H2,1-3H3/b17-11+ |
| InChIKey | ANQIAPWHVLHCKK-GZTJUZNOSA-N |
| XLogP | 2.03 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|