C20H13F2N4O2+ — CID 91302359
5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-3-(furan-2-yl)-1,2-oxazole (PubChem CID 91302359) has the molecular formula C20H13F2N4O2+ and a molecular weight of 379.35 g/mol. Its IUPAC name is 5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-3-(furan-2-yl)-1,2-oxazole.
| Compound Name | 5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-3-(furan-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 91302359 |
| Molecular Formula | C20H13F2N4O2+ |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-3-(furan-2-yl)-1,2-oxazole |
| SMILES | Fc1cccc(-c2nc3cc[n+](Cc4cc(-c5ccco5)no4)cc3[nH]2)c1F |
| InChI | InChI=1S/C20H12F2N4O2/c21-14-4-1-3-13(19(14)22)20-23-15-6-7-26(11-17(15)24-20)10-12-9-16(25-28-12)18-5-2-8-27-18/h1-9,11H,10H2/p+1 |
| InChIKey | GEHPOVRWMNZPLK-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|