C20H21ClF3NO2 — CID 91303129
ethyl 3-chloro-2-(dibenzylamino)-4,4,4-trifluorobutanoate (PubChem CID 91303129) has the molecular formula C20H21ClF3NO2 and a molecular weight of 399.84 g/mol. Its IUPAC name is ethyl 3-chloro-2-(dibenzylamino)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-chloro-2-(dibenzylamino)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 91303129 |
| Molecular Formula | C20H21ClF3NO2 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | ethyl 3-chloro-2-(dibenzylamino)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C(C(Cl)C(F)(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H21ClF3NO2/c1-2-27-19(26)17(18(21)20(22,23)24)25(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12,17-18H,2,13-14H2,1H3 |
| InChIKey | FYKCFSUTQCFPGY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|