C21H27NO4 — CID 91304826
[2-(3,3-diethoxy-2-phenylpropyl)phenyl] 2-aminoacetate (PubChem CID 91304826) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-(3,3-diethoxy-2-phenylpropyl)phenyl] 2-aminoacetate.
| Compound Name | [2-(3,3-diethoxy-2-phenylpropyl)phenyl] 2-aminoacetate |
|---|---|
| PubChem CID | 91304826 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-(3,3-diethoxy-2-phenylpropyl)phenyl] 2-aminoacetate |
| SMILES | CCOC(OCC)C(Cc1ccccc1OC(=O)CN)c1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c1-3-24-21(25-4-2)18(16-10-6-5-7-11-16)14-17-12-8-9-13-19(17)26-20(23)15-22/h5-13,18,21H,3-4,14-15,22H2,1-2H3 |
| InChIKey | YRFMHNBPFZIFJX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|