C18H19FO7 — CID 91308389
methyl 1,5-diacetyloxy-3-(4-fluorophenyl)-4-hydroxycyclohex-2-ene-1-carboxylate (PubChem CID 91308389) has the molecular formula C18H19FO7 and a molecular weight of 366.34 g/mol. Its IUPAC name is methyl 1,5-diacetyloxy-3-(4-fluorophenyl)-4-hydroxycyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 1,5-diacetyloxy-3-(4-fluorophenyl)-4-hydroxycyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 91308389 |
| Molecular Formula | C18H19FO7 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 1,5-diacetyloxy-3-(4-fluorophenyl)-4-hydroxycyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)C=C(c2ccc(F)cc2)C(O)C(OC(C)=O)C1 |
| InChI | InChI=1S/C18H19FO7/c1-10(20)25-15-9-18(17(23)24-3,26-11(2)21)8-14(16(15)22)12-4-6-13(19)7-5-12/h4-8,15-16,22H,9H2,1-3H3 |
| InChIKey | ZRLKPLGNMLNUHY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|