C11H21N3S — CID 91309072
1-(4-ethylsulfanyl-2,4-dimethylpentan-2-yl)triazole (PubChem CID 91309072) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 1-(4-ethylsulfanyl-2,4-dimethylpentan-2-yl)triazole.
| Compound Name | 1-(4-ethylsulfanyl-2,4-dimethylpentan-2-yl)triazole |
|---|---|
| PubChem CID | 91309072 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(4-ethylsulfanyl-2,4-dimethylpentan-2-yl)triazole |
| SMILES | CCSC(C)(C)CC(C)(C)n1ccnn1 |
| InChI | InChI=1S/C11H21N3S/c1-6-15-11(4,5)9-10(2,3)14-8-7-12-13-14/h7-8H,6,9H2,1-5H3 |
| InChIKey | NJKMTSOZFLNGDW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |