C9H15N5O2 — CID 54217361
[[2-methyl-2-(triazol-1-yl)butylidene]amino] N-methylcarbamate (PubChem CID 54217361) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is [[2-methyl-2-(triazol-1-yl)butylidene]amino] N-methylcarbamate.
| Compound Name | [[2-methyl-2-(triazol-1-yl)butylidene]amino] N-methylcarbamate |
|---|---|
| PubChem CID | 54217361 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [[2-methyl-2-(triazol-1-yl)butylidene]amino] N-methylcarbamate |
| SMILES | CCC(C)(C=NOC(=O)NC)n1ccnn1 |
| InChI | InChI=1S/C9H15N5O2/c1-4-9(2,14-6-5-11-13-14)7-12-16-8(15)10-3/h5-7H,4H2,1-3H3,(H,10,15) |
| InChIKey | QADNFDXHHXWUCE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|