C7H12N2 — CID 91312795
1-N-ethyl-2-N-ethylideneprop-2-ene-1,2-diimine (PubChem CID 91312795) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-N-ethyl-2-N-ethylideneprop-2-ene-1,2-diimine.
| Compound Name | 1-N-ethyl-2-N-ethylideneprop-2-ene-1,2-diimine |
|---|---|
| PubChem CID | 91312795 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-N-ethyl-2-N-ethylideneprop-2-ene-1,2-diimine |
| SMILES | C=C(/C=N/CC)/N=C/C |
| InChI | InChI=1S/C7H12N2/c1-4-8-6-7(3)9-5-2/h5-6H,3-4H2,1-2H3/b8-6+,9-5+ |
| InChIKey | IETSTJRKQRVCBH-RFSWUZDDSA-N |
| XLogP | 1.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|