C11H9NO3S2 — CID 91313197
methyl 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate (PubChem CID 91313197) has the molecular formula C11H9NO3S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate.
| Compound Name | methyl 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 91313197 |
| Molecular Formula | C11H9NO3S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | methyl 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate |
| SMILES | COC(=O)c1cccc(-n2c(O)csc2=S)c1 |
| InChI | InChI=1S/C11H9NO3S2/c1-15-10(14)7-3-2-4-8(5-7)12-9(13)6-17-11(12)16/h2-6,13H,1H3 |
| InChIKey | BTAIOLBEORTGFQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|