C9H15N — CID 91316764
4,5-dimethyl-2-prop-1-en-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 91316764) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 4,5-dimethyl-2-prop-1-en-2-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | 4,5-dimethyl-2-prop-1-en-2-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 91316764 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4,5-dimethyl-2-prop-1-en-2-yl-3,4-dihydro-2H-pyrrole |
| SMILES | C=C(C)C1CC(C)C(C)=N1 |
| InChI | InChI=1S/C9H15N/c1-6(2)9-5-7(3)8(4)10-9/h7,9H,1,5H2,2-4H3 |
| InChIKey | VSBGUVGIRLEYBW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|