C16H31N — CID 123459444
N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhexan-2-imine (PubChem CID 123459444) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhexan-2-imine.
| Compound Name | N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhexan-2-imine |
|---|---|
| PubChem CID | 123459444 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhexan-2-imine |
| SMILES | C=C(C)C(CC(C)C)/N=C(\C)CC(C)(C)CC |
| InChI | InChI=1S/C16H31N/c1-9-16(7,8)11-14(6)17-15(13(4)5)10-12(2)3/h12,15H,4,9-11H2,1-3,5-8H3/b17-14+ |
| InChIKey | IVZGGLFUPBVOTN-SAPNQHFASA-N |
| XLogP | 5.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|