C16H31N — CID 167253194
3,3-dimethyl-N-(3,5,5-trimethyl-4-methylidenehexan-2-yl)butan-2-imine (PubChem CID 167253194) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 3,3-dimethyl-N-(3,5,5-trimethyl-4-methylidenehexan-2-yl)butan-2-imine.
| Compound Name | 3,3-dimethyl-N-(3,5,5-trimethyl-4-methylidenehexan-2-yl)butan-2-imine |
|---|---|
| PubChem CID | 167253194 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 3,3-dimethyl-N-(3,5,5-trimethyl-4-methylidenehexan-2-yl)butan-2-imine |
| SMILES | C=C(C(C)C(C)/N=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H31N/c1-11(12(2)15(5,6)7)13(3)17-14(4)16(8,9)10/h11,13H,2H2,1,3-10H3/b17-14+ |
| InChIKey | VCPGZAYGHOAKKT-SAPNQHFASA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|