C12H23NO — CID 155029838
(Z)-2-(3,3-dimethylbutan-2-ylideneamino)-4-methylpent-2-en-3-ol (PubChem CID 155029838) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (Z)-2-(3,3-dimethylbutan-2-ylideneamino)-4-methylpent-2-en-3-ol.
| Compound Name | (Z)-2-(3,3-dimethylbutan-2-ylideneamino)-4-methylpent-2-en-3-ol |
|---|---|
| PubChem CID | 155029838 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (Z)-2-(3,3-dimethylbutan-2-ylideneamino)-4-methylpent-2-en-3-ol |
| SMILES | CC(/N=C(\C)C(C)(C)C)=C(/O)C(C)C |
| InChI | InChI=1S/C12H23NO/c1-8(2)11(14)9(3)13-10(4)12(5,6)7/h8,14H,1-7H3/b11-9-,13-10+ |
| InChIKey | BZMLYHBTWVSNLG-SZJZEYKYSA-N |
| XLogP | 3.94 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|