C10H22N2 — CID 126709395
N-[(E)-3,3-dimethylbutan-2-ylideneamino]-N-methylpropan-2-amine (PubChem CID 126709395) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N-[(E)-3,3-dimethylbutan-2-ylideneamino]-N-methylpropan-2-amine.
| Compound Name | N-[(E)-3,3-dimethylbutan-2-ylideneamino]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 126709395 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N-[(E)-3,3-dimethylbutan-2-ylideneamino]-N-methylpropan-2-amine |
| SMILES | C/C(=N\N(C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H22N2/c1-8(2)12(7)11-9(3)10(4,5)6/h8H,1-7H3/b11-9+ |
| InChIKey | OLJSDJDOFPWSNI-PKNBQFBNSA-N |
| XLogP | 2.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|