C11H24N2O — CID 14824858
(6E)-6-(dimethylhydrazinylidene)-2,3-dimethylheptan-3-ol (PubChem CID 14824858) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (6E)-6-(dimethylhydrazinylidene)-2,3-dimethylheptan-3-ol.
| Compound Name | (6E)-6-(dimethylhydrazinylidene)-2,3-dimethylheptan-3-ol |
|---|---|
| PubChem CID | 14824858 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (6E)-6-(dimethylhydrazinylidene)-2,3-dimethylheptan-3-ol |
| SMILES | C/C(CCC(C)(O)C(C)C)=N\N(C)C |
| InChI | InChI=1S/C11H24N2O/c1-9(2)11(4,14)8-7-10(3)12-13(5)6/h9,14H,7-8H2,1-6H3/b12-10+ |
| InChIKey | XNYSLOLIONFWIR-ZRDIBKRKSA-N |
| XLogP | 2.11 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|