C13H24O2 — CID 156834915
(Z)-8-hydroxy-4,8,9-trimethyldec-4-enal (PubChem CID 156834915) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (Z)-8-hydroxy-4,8,9-trimethyldec-4-enal.
| Compound Name | (Z)-8-hydroxy-4,8,9-trimethyldec-4-enal |
|---|---|
| PubChem CID | 156834915 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (Z)-8-hydroxy-4,8,9-trimethyldec-4-enal |
| SMILES | C/C(=C/CCC(C)(O)C(C)C)CCC=O |
| InChI | InChI=1S/C13H24O2/c1-11(2)13(4,15)9-5-7-12(3)8-6-10-14/h7,10-11,15H,5-6,8-9H2,1-4H3/b12-7- |
| InChIKey | ZGOQSRAXWXGEIB-GHXNOFRVSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|