C19H32O — CID 135190023
(4E,8E,12E)-4,5,12-trimethylhexadeca-4,8,12-trienal (PubChem CID 135190023) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (4E,8E,12E)-4,5,12-trimethylhexadeca-4,8,12-trienal.
| Compound Name | (4E,8E,12E)-4,5,12-trimethylhexadeca-4,8,12-trienal |
|---|---|
| PubChem CID | 135190023 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (4E,8E,12E)-4,5,12-trimethylhexadeca-4,8,12-trienal |
| SMILES | CCC/C=C(\C)CC/C=C/CC/C(C)=C(\C)CCC=O |
| InChI | InChI=1S/C19H32O/c1-5-6-12-17(2)13-9-7-8-10-14-18(3)19(4)15-11-16-20/h7-8,12,16H,5-6,9-11,13-15H2,1-4H3/b8-7+,17-12+,19-18+ |
| InChIKey | RLSAYHWKAHGETJ-HIQSRIMISA-N |
| XLogP | 6.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|