C13H15N3O6 — CID 91317798
3-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-methylpropanoyl)oxolan-2-yl]-2,6-dioxopyrimidine-4-carbonitrile (PubChem CID 91317798) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-methylpropanoyl)oxolan-2-yl]-2,6-dioxopyrimidine-4-carbonitrile.
| Compound Name | 3-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-methylpropanoyl)oxolan-2-yl]-2,6-dioxopyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 91317798 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-methylpropanoyl)oxolan-2-yl]-2,6-dioxopyrimidine-4-carbonitrile |
| SMILES | CC(C)C(=O)[C@H]1O[C@@H](n2c(C#N)cc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15N3O6/c1-5(2)8(18)11-9(19)10(20)12(22-11)16-6(4-14)3-7(17)15-13(16)21/h3,5,9-12,19-20H,1-2H3,(H,15,17,21)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | QAPJLAQUSJLAJS-IRCOFANPSA-N |
| XLogP | -1.75 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |