C9H10O5 — CID 91320259
3-methyl-5-oxocyclohex-3-ene-1,1-dicarboxylic acid (PubChem CID 91320259) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 3-methyl-5-oxocyclohex-3-ene-1,1-dicarboxylic acid.
| Compound Name | 3-methyl-5-oxocyclohex-3-ene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 91320259 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-methyl-5-oxocyclohex-3-ene-1,1-dicarboxylic acid |
| SMILES | CC1=CC(=O)CC(C(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C9H10O5/c1-5-2-6(10)4-9(3-5,7(11)12)8(13)14/h2H,3-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | VQSZXJFLDXZASF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|