C24H16F4N4O3 — CID 91320323
1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-(7-nitro-1H-indol-3-yl)propan-2-ol (PubChem CID 91320323) has the molecular formula C24H16F4N4O3 and a molecular weight of 484.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-(7-nitro-1H-indol-3-yl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-(7-nitro-1H-indol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 91320323 |
| Molecular Formula | C24H16F4N4O3 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-(7-nitro-1H-indol-3-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc2c(CC(O)(c3ccc4c(cnn4-c4ccc(F)cc4)c3)C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C24H16F4N4O3/c25-17-5-7-18(8-6-17)31-20-9-4-16(10-14(20)13-30-31)23(33,24(26,27)28)11-15-12-29-22-19(15)2-1-3-21(22)32(34)35/h1-10,12-13,29,33H,11H2 |
| InChIKey | LZORSVDKRKHMAV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|