About methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene
methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene (PubChem CID 91321532) has the molecular formula C12H17N3O5
and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene.
Molecular Properties
| Compound Name | methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene |
| PubChem CID | 91321532 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene |
| SMILES | CNC(=O)N(C)CC(=O)OC.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H12N2O3.C6H5NO2/c1-7-6(10)8(2)4-5(9)11-3;8-7(9)6-4-2-1-3-5-6/h4H2,1-3H3,(H,7,10);1-5H |
| InChIKey | DORSHAUZEGKPLM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene?
The IUPAC name of methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene (CID 91321532) is methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene.
What is the SMILES notation for methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene?
The canonical SMILES for methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene is CNC(=O)N(C)CC(=O)OC.O=[N+]([O-])c1ccccc1.
What is the InChIKey of methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene?
The InChIKey is DORSHAUZEGKPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3.C6H5NO2/c1-7-6(10)8(2)4-5(9)11-3;8-7(9)6-4-2-1-3-5-6/h4H2,1-3H3,(H,7,10);1-5H.
What are the key properties of methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene?
methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene has a molecular weight of 283.28 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(methylcarbamoyl)amino]acetate;nitrobenzene is sourced from PubChem (CID 91321532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).