C27H29N3O6 — CID 91322289
(4R)-5-[[(3S)-1-benzylpyrrolidin-3-yl]methoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid (PubChem CID 91322289) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is (4R)-5-[[(3S)-1-benzylpyrrolidin-3-yl]methoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid.
| Compound Name | (4R)-5-[[(3S)-1-benzylpyrrolidin-3-yl]methoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 91322289 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (4R)-5-[[(3S)-1-benzylpyrrolidin-3-yl]methoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)OC[C@H]2CCN(Cc3ccccc3)C2)[C@@H](c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C27H29N3O6/c1-17-23(26(31)32)25(21-9-6-10-22(13-21)30(34)35)24(18(2)28-17)27(33)36-16-20-11-12-29(15-20)14-19-7-4-3-5-8-19/h3-10,13,20,23,25H,11-12,14-16H2,1-2H3,(H,31,32)/t20-,23?,25-/m0/s1 |
| InChIKey | AISINIQQNGZBCW-XTBBCBASSA-N |
| XLogP | 4.19 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|