C17H14Cl2N2O — CID 91322838
1-[2-(3,4-dichlorophenoxy)quinolin-3-yl]ethanamine (PubChem CID 91322838) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenoxy)quinolin-3-yl]ethanamine.
| Compound Name | 1-[2-(3,4-dichlorophenoxy)quinolin-3-yl]ethanamine |
|---|---|
| PubChem CID | 91322838 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-[2-(3,4-dichlorophenoxy)quinolin-3-yl]ethanamine |
| SMILES | CC(N)c1cc2ccccc2nc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-10(20)13-8-11-4-2-3-5-16(11)21-17(13)22-12-6-7-14(18)15(19)9-12/h2-10H,20H2,1H3 |
| InChIKey | WULGCEUCKQHXHW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |