C30H34FN4O+ — CID 91323669
[4-butyl-4-[(1S)-2-(4-fluorophenyl)-1-(1H-imidazol-5-yl)ethyl]piperazin-4-ium-1-yl]-naphthalen-1-ylmethanone (PubChem CID 91323669) has the molecular formula C30H34FN4O+ and a molecular weight of 485.63 g/mol. Its IUPAC name is [4-butyl-4-[(1S)-2-(4-fluorophenyl)-1-(1H-imidazol-5-yl)ethyl]piperazin-4-ium-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-butyl-4-[(1S)-2-(4-fluorophenyl)-1-(1H-imidazol-5-yl)ethyl]piperazin-4-ium-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 91323669 |
| Molecular Formula | C30H34FN4O+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | [4-butyl-4-[(1S)-2-(4-fluorophenyl)-1-(1H-imidazol-5-yl)ethyl]piperazin-4-ium-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCC[N+]1(C(Cc2ccc(F)cc2)c2cnc[nH]2)CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C30H34FN4O/c1-2-3-17-35(29(28-21-32-22-33-28)20-23-11-13-25(31)14-12-23)18-15-34(16-19-35)30(36)27-10-6-8-24-7-4-5-9-26(24)27/h4-14,21-22,29H,2-3,15-20H2,1H3,(H,32,33)/q+1 |
| InChIKey | RUFSIHNVDJAQTG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|