C11H21NO6 — CID 91323839
(2S,3R,4S,5S,6R)-N-butyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide (PubChem CID 91323839) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-N-butyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide.
| Compound Name | (2S,3R,4S,5S,6R)-N-butyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 91323839 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-N-butyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO6/c1-2-3-4-12-11(17)10-9(16)8(15)7(14)6(5-13)18-10/h6-10,13-16H,2-5H2,1H3,(H,12,17)/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | CHZXGMFBMXABEG-SPFKKGSWSA-N |
| XLogP | -2.25 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|