C9H14N2O7 — CID 10400457
(6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 10400457) has the molecular formula C9H14N2O7 and a molecular weight of 262.22 g/mol. Its IUPAC name is (6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 10400457 |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CNC(=O)[C@@]2(N1)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C9H14N2O7/c12-2-3-5(14)6(15)7(16)9(18-3)8(17)10-1-4(13)11-9/h3,5-7,12,14-16H,1-2H2,(H,10,17)(H,11,13)/t3-,5-,6+,7-,9+/m1/s1 |
| InChIKey | BUENWPZCHAHNFK-NAIRZZCHSA-N |
| XLogP | -4.60 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |