C31H41NO9 — CID 91325877
[4-[(2S)-2-amino-3-oxo-3-[(2S)-2-phenoxycarbonyloxypropoxy]propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate (PubChem CID 91325877) has the molecular formula C31H41NO9 and a molecular weight of 571.67 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-phenoxycarbonyloxypropoxy]propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-phenoxycarbonyloxypropoxy]propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate |
|---|---|
| PubChem CID | 91325877 |
| Molecular Formula | C31H41NO9 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-phenoxycarbonyloxypropoxy]propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)Oc2ccccc2)cc1OC(=O)CC(C)CC |
| InChI | InChI=1S/C31H41NO9/c1-6-20(3)15-28(33)40-26-14-13-23(18-27(26)41-29(34)16-21(4)7-2)17-25(32)30(35)37-19-22(5)38-31(36)39-24-11-9-8-10-12-24/h8-14,18,20-22,25H,6-7,15-17,19,32H2,1-5H3/t20?,21?,22-,25-/m0/s1 |
| InChIKey | LFIYLURISIOYAB-YQDNHFOKSA-N |
| XLogP | 5.39 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|