C24H37NO2 — CID 91326549
cumene;5-methyl-2-(4-methylpentyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 91326549) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is cumene;5-methyl-2-(4-methylpentyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | cumene;5-methyl-2-(4-methylpentyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 91326549 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | cumene;5-methyl-2-(4-methylpentyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC(C)CCCN1C(=O)C2CCC(C)CC2C1=O.CC(C)c1ccccc1 |
| InChI | InChI=1S/C15H25NO2.C9H12/c1-10(2)5-4-8-16-14(17)12-7-6-11(3)9-13(12)15(16)18;1-8(2)9-6-4-3-5-7-9/h10-13H,4-9H2,1-3H3;3-8H,1-2H3 |
| InChIKey | HGNXTGYQTMOCLJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|