C14H17BrN2O7 — CID 91327137
1-[(2R,3R,4S,5S)-4-acetyl-3-bromo-4-hydroxy-5-(2-hydroxypropanoyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 91327137) has the molecular formula C14H17BrN2O7 and a molecular weight of 405.20 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-4-acetyl-3-bromo-4-hydroxy-5-(2-hydroxypropanoyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-4-acetyl-3-bromo-4-hydroxy-5-(2-hydroxypropanoyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91327137 |
| Molecular Formula | C14H17BrN2O7 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-4-acetyl-3-bromo-4-hydroxy-5-(2-hydroxypropanoyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC(=O)[C@@]1(O)[C@@H](C(=O)C(C)O)O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@@H]1Br |
| InChI | InChI=1S/C14H17BrN2O7/c1-5-4-17(13(22)16-11(5)21)12-9(15)14(23,7(3)19)10(24-12)8(20)6(2)18/h4,6,9-10,12,18,23H,1-3H3,(H,16,21,22)/t6?,9-,10+,12+,14-/m0/s1 |
| InChIKey | TTXYAUPKLMJRCD-USAYPXNZSA-N |
| XLogP | -1.22 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|