C16H23ClN2O8S — CID 141420170
1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 141420170) has the molecular formula C16H23ClN2O8S and a molecular weight of 438.89 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141420170 |
| Molecular Formula | C16H23ClN2O8S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](C(O)C(=O)C(C)(C)C)[C@](O)(S(C)(=O)=O)C2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H23ClN2O8S/c1-7-6-19(14(23)18-12(7)22)13-9(17)16(24,28(5,25)26)11(27-13)8(20)10(21)15(2,3)4/h6,8-9,11,13,20,24H,1-5H3,(H,18,22,23)/t8?,9?,11-,13-,16-/m1/s1 |
| InChIKey | FJHDSBOKIXGOPG-LRNQHSLLSA-N |
| XLogP | -0.94 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|