C22H25F3IN3O7 — CID 86744503
5-methyl-1-[(2S,4S,5R)-2,3,3-trifluoro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-(1-methyl-2,3-dihydropyridin-3-ylium-2-carbonyl)oxolan-2-yl]pyrimidine-2,4-dione iodide (PubChem CID 86744503) has the molecular formula C22H25F3IN3O7 and a molecular weight of 627.35 g/mol. Its IUPAC name is 5-methyl-1-[(2S,4S,5R)-2,3,3-trifluoro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-(1-methyl-2,3-dihydropyridin-3-ylium-2-carbonyl)oxolan-2-yl]pyrimidine-2,4-dione iodide.
| Compound Name | 5-methyl-1-[(2S,4S,5R)-2,3,3-trifluoro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-(1-methyl-2,3-dihydropyridin-3-ylium-2-carbonyl)oxolan-2-yl]pyrimidine-2,4-dione iodide |
|---|---|
| PubChem CID | 86744503 |
| Molecular Formula | C22H25F3IN3O7 |
| Molecular Weight | 627.35 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | 5-methyl-1-[(2S,4S,5R)-2,3,3-trifluoro-4-hydroxy-5-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-4-(1-methyl-2,3-dihydropyridin-3-ylium-2-carbonyl)oxolan-2-yl]pyrimidine-2,4-dione iodide |
| SMILES | Cc1cn([C@]2(F)O[C@H](C(O)C(=O)C(C)(C)C)[C@](O)(C(=O)C3[C+]=CC=CN3C)C2(F)F)c(=O)[nH]c1=O.[I-] |
| InChI | InChI=1S/C22H24F3N3O7.HI/c1-11-10-28(18(33)26-17(11)32)22(25)21(23,24)20(34,14(30)12-8-6-7-9-27(12)5)16(35-22)13(29)15(31)19(2,3)4;/h6-7,9-10,12-13,16,29,34H,1-5H3;1H/t12?,13?,16-,20-,22+;/m1./s1 |
| InChIKey | VZKPFCDZLJZTPI-HQZNFGJLSA-N |
| XLogP | -3.07 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.35 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|