C9H9FN2O3 — CID 171628934
1-[(3R)-3-fluoro-2H-furan-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 171628934) has the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. Its IUPAC name is 1-[(3R)-3-fluoro-2H-furan-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3R)-3-fluoro-2H-furan-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171628934 |
| Molecular Formula | C9H9FN2O3 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-[(3R)-3-fluoro-2H-furan-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@]2(F)C=COC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H9FN2O3/c1-6-4-12(8(14)11-7(6)13)9(10)2-3-15-5-9/h2-4H,5H2,1H3,(H,11,13,14)/t9-/m0/s1 |
| InChIKey | GJHJNIRBPUFJOE-VIFPVBQESA-N |
| XLogP | 0.01 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |