About 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione
1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 57012135) has the molecular formula C10H14N2O4S
and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione |
| PubChem CID | 57012135 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2(CO)CSCCO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4S/c1-7-4-12(9(15)11-8(7)14)10(5-13)6-17-3-2-16-10/h4,13H,2-3,5-6H2,1H3,(H,11,14,15) |
| InChIKey | CIPAANMTXBNWPD-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione?
The IUPAC name of 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione (CID 57012135) is 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione?
The canonical SMILES for 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione is Cc1cn(C2(CO)CSCCO2)c(=O)[nH]c1=O.
What is the InChIKey of 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione?
The InChIKey is CIPAANMTXBNWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4S/c1-7-4-12(9(15)11-8(7)14)10(5-13)6-17-3-2-16-10/h4,13H,2-3,5-6H2,1H3,(H,11,14,15).
What are the key properties of 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione?
1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione has a molecular weight of 258.30 g/mol, XLogP of -0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(hydroxymethyl)-1,4-oxathian-2-yl]-5-methylpyrimidine-2,4-dione is sourced from PubChem (CID 57012135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).