C30H29ClN2O7S — CID 141420168
1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-2,2,2-triphenylethyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 141420168) has the molecular formula C30H29ClN2O7S and a molecular weight of 597.09 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-2,2,2-triphenylethyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-2,2,2-triphenylethyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141420168 |
| Molecular Formula | C30H29ClN2O7S |
| Molecular Weight | 597.09 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 1-[(2R,4S,5R)-3-chloro-4-hydroxy-5-(1-hydroxy-2,2,2-triphenylethyl)-4-methylsulfonyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](C(O)C(c3ccccc3)(c3ccccc3)c3ccccc3)[C@](O)(S(C)(=O)=O)C2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H29ClN2O7S/c1-19-18-33(28(36)32-26(19)35)27-23(31)30(37,41(2,38)39)25(40-27)24(34)29(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-18,23-25,27,34,37H,1-2H3,(H,32,35,36)/t23?,24?,25-,27-,30-/m1/s1 |
| InChIKey | ZQCQAGWDTZQEDR-JAWMUPOQSA-N |
| XLogP | 2.48 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.09 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|