C18H23BrN4O2S — CID 91327378
4-[(5-bromothiophen-3-yl)carbamoylamino]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 91327378) has the molecular formula C18H23BrN4O2S and a molecular weight of 439.38 g/mol. Its IUPAC name is 4-[(5-bromothiophen-3-yl)carbamoylamino]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[(5-bromothiophen-3-yl)carbamoylamino]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 91327378 |
| Molecular Formula | C18H23BrN4O2S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-[(5-bromothiophen-3-yl)carbamoylamino]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)Nc2csc(Br)c2)cc1 |
| InChI | InChI=1S/C18H23BrN4O2S/c1-3-23(4-2)10-9-20-17(24)13-5-7-14(8-6-13)21-18(25)22-15-11-16(19)26-12-15/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,20,24)(H2,21,22,25) |
| InChIKey | RTMNUANUTKYORG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |