C17H23N5O3 — CID 91324654
N-[2-(diethylamino)ethyl]-4-(1,3-oxazol-4-ylcarbamoylamino)benzamide (PubChem CID 91324654) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-(1,3-oxazol-4-ylcarbamoylamino)benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-(1,3-oxazol-4-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 91324654 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-(1,3-oxazol-4-ylcarbamoylamino)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)Nc2cocn2)cc1 |
| InChI | InChI=1S/C17H23N5O3/c1-3-22(4-2)10-9-18-16(23)13-5-7-14(8-6-13)20-17(24)21-15-11-25-12-19-15/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,18,23)(H2,20,21,24) |
| InChIKey | CZUHYBBILHSMGK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |